About 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid
6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid (PubChem CID 83909638) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid.
Molecular Properties
| Compound Name | 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid |
| PubChem CID | 83909638 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid |
| SMILES | CCc1cc2c(s1)C(N)(C(=O)O)CC2 |
| InChI | InChI=1S/C10H13NO2S/c1-2-7-5-6-3-4-10(11,9(12)13)8(6)14-7/h5H,2-4,11H2,1H3,(H,12,13) |
| InChIKey | PWNYXOXTHULFKK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid?
The IUPAC name of 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid (CID 83909638) is 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid.
What is the SMILES notation for 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid?
The canonical SMILES for 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid is CCc1cc2c(s1)C(N)(C(=O)O)CC2.
What is the InChIKey of 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid?
The InChIKey is PWNYXOXTHULFKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-2-7-5-6-3-4-10(11,9(12)13)8(6)14-7/h5H,2-4,11H2,1H3,(H,12,13).
What are the key properties of 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid?
6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid has a molecular weight of 211.29 g/mol, XLogP of 1.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-ethyl-4,5-dihydrocyclopenta[b]thiophene-6-carboxylic acid is sourced from PubChem (CID 83909638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).