About 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid
4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid (PubChem CID 83909751) has the molecular formula C10H12O3S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid |
| PubChem CID | 83909751 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid |
| SMILES | Cc1cc2c(s1)CCCC2(O)C(=O)O |
| InChI | InChI=1S/C10H12O3S/c1-6-5-7-8(14-6)3-2-4-10(7,13)9(11)12/h5,13H,2-4H2,1H3,(H,11,12) |
| InChIKey | HVIGBOLYNMNQPE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid?
The IUPAC name of 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid (CID 83909751) is 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid.
What is the SMILES notation for 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid?
The canonical SMILES for 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid is Cc1cc2c(s1)CCCC2(O)C(=O)O.
What is the InChIKey of 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid?
The InChIKey is HVIGBOLYNMNQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c1-6-5-7-8(14-6)3-2-4-10(7,13)9(11)12/h5,13H,2-4H2,1H3,(H,11,12).
What are the key properties of 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid?
4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid is sourced from PubChem (CID 83909751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).