About 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde
3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde (PubChem CID 83910012) has the molecular formula C7H6BrNO2
and a molecular weight of 216.03 g/mol. Its IUPAC name is 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 83910012 |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1c(Br)noc1C1CC1 |
| InChI | InChI=1S/C7H6BrNO2/c8-7-5(3-10)6(11-9-7)4-1-2-4/h3-4H,1-2H2 |
| InChIKey | ACQBFUHLMZOSOZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde (CID 83910012) is 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde is O=Cc1c(Br)noc1C1CC1.
What is the InChIKey of 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde?
The InChIKey is ACQBFUHLMZOSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2/c8-7-5(3-10)6(11-9-7)4-1-2-4/h3-4H,1-2H2.
What are the key properties of 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde?
3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde has a molecular weight of 216.03 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-cyclopropyl-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 83910012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).