About 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 83911210) has the molecular formula C11H12ClNO2
and a molecular weight of 225.68 g/mol. Its IUPAC name is 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid |
| PubChem CID | 83911210 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid |
| SMILES | NC1(C(=O)O)CCCc2c(Cl)cccc21 |
| InChI | InChI=1S/C11H12ClNO2/c12-9-5-1-4-8-7(9)3-2-6-11(8,13)10(14)15/h1,4-5H,2-3,6,13H2,(H,14,15) |
| InChIKey | BJHOGOCBKJGOAS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The IUPAC name of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CID 83911210) is 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
What is the SMILES notation for 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The canonical SMILES for 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid is NC1(C(=O)O)CCCc2c(Cl)cccc21.
What is the InChIKey of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The InChIKey is BJHOGOCBKJGOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c12-9-5-1-4-8-7(9)3-2-6-11(8,13)10(14)15/h1,4-5H,2-3,6,13H2,(H,14,15).
What are the key properties of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid has a molecular weight of 225.68 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 83911210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).