1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid

C11H12ClNO2 — CID 83911210

IUPAC1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
SMILESNC1(C(=O)O)CCCc2c(Cl)cccc21
InChIInChI=1S/C11H12ClNO2/c12-9-5-1-4-8-7(9)3-2-6-11(8,13)10(14)15/h1,4-5H,2-3,6,13H2,(H,14,15)
InChIKeyBJHOGOCBKJGOAS-UHFFFAOYSA-N
MW225.68 g/mol
LogP1.91
Rot. Bonds1

About 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid

1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 83911210) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.

Molecular Properties

Compound Name1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
PubChem CID83911210
Molecular FormulaC11H12ClNO2
Molecular Weight225.68 g/mol
Exact Mass225.06
IUPAC Name1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
SMILESNC1(C(=O)O)CCCc2c(Cl)cccc21
InChIInChI=1S/C11H12ClNO2/c12-9-5-1-4-8-7(9)3-2-6-11(8,13)10(14)15/h1,4-5H,2-3,6,13H2,(H,14,15)
InChIKeyBJHOGOCBKJGOAS-UHFFFAOYSA-N
XLogP1.91
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.68
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The IUPAC name of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CID 83911210) is 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
What is the SMILES notation for 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The canonical SMILES for 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid is NC1(C(=O)O)CCCc2c(Cl)cccc21.
What is the InChIKey of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The InChIKey is BJHOGOCBKJGOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c12-9-5-1-4-8-7(9)3-2-6-11(8,13)10(14)15/h1,4-5H,2-3,6,13H2,(H,14,15).
What are the key properties of 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid has a molecular weight of 225.68 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-5-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 83911210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).