About 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol
2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol (PubChem CID 83911307) has the molecular formula C11H14FNOS
and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol |
| PubChem CID | 83911307 |
| Molecular Formula | C11H14FNOS |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol |
| SMILES | NCC(O)C1CCSc2c(F)cccc21 |
| InChI | InChI=1S/C11H14FNOS/c12-9-3-1-2-8-7(10(14)6-13)4-5-15-11(8)9/h1-3,7,10,14H,4-6,13H2 |
| InChIKey | UAJARUZTJGHJHD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol?
The IUPAC name of 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol (CID 83911307) is 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol.
What is the SMILES notation for 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol?
The canonical SMILES for 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol is NCC(O)C1CCSc2c(F)cccc21.
What is the InChIKey of 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol?
The InChIKey is UAJARUZTJGHJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNOS/c12-9-3-1-2-8-7(10(14)6-13)4-5-15-11(8)9/h1-3,7,10,14H,4-6,13H2.
What are the key properties of 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol?
2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol has a molecular weight of 227.30 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)ethanol is sourced from PubChem (CID 83911307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).