About 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid
2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid (PubChem CID 83911740) has the molecular formula C9H9ClO3S
and a molecular weight of 232.69 g/mol. Its IUPAC name is 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid |
| PubChem CID | 83911740 |
| Molecular Formula | C9H9ClO3S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid |
| SMILES | O=C(O)CC1(O)CCc2cc(Cl)sc21 |
| InChI | InChI=1S/C9H9ClO3S/c10-6-3-5-1-2-9(13,4-7(11)12)8(5)14-6/h3,13H,1-2,4H2,(H,11,12) |
| InChIKey | PREZKGQAYJKPMV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid?
The IUPAC name of 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid (CID 83911740) is 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid.
What is the SMILES notation for 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid?
The canonical SMILES for 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid is O=C(O)CC1(O)CCc2cc(Cl)sc21.
What is the InChIKey of 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid?
The InChIKey is PREZKGQAYJKPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO3S/c10-6-3-5-1-2-9(13,4-7(11)12)8(5)14-6/h3,13H,1-2,4H2,(H,11,12).
What are the key properties of 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid?
2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid has a molecular weight of 232.69 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-6-hydroxy-4,5-dihydrocyclopenta[b]thiophen-6-yl)acetic acid is sourced from PubChem (CID 83911740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).