About 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine
2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine (PubChem CID 83912827) has the molecular formula C9H14BrN3
and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine |
| PubChem CID | 83912827 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine |
| SMILES | Cn1nc2c(c1Br)C(CCN)CC2 |
| InChI | InChI=1S/C9H14BrN3/c1-13-9(10)8-6(4-5-11)2-3-7(8)12-13/h6H,2-5,11H2,1H3 |
| InChIKey | KXVWVEDHCWWDQB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine?
The IUPAC name of 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine (CID 83912827) is 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine.
What is the SMILES notation for 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine?
The canonical SMILES for 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine is Cn1nc2c(c1Br)C(CCN)CC2.
What is the InChIKey of 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine?
The InChIKey is KXVWVEDHCWWDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN3/c1-13-9(10)8-6(4-5-11)2-3-7(8)12-13/h6H,2-5,11H2,1H3.
What are the key properties of 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine?
2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine has a molecular weight of 244.14 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl)ethanamine is sourced from PubChem (CID 83912827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).