About 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid
3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83913361) has the molecular formula C8H9BrN2O3
and a molecular weight of 261.07 g/mol. Its IUPAC name is 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid.
Analyze 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83913361) is 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid is O=C(O)C1(O)CCCc2[nH]nc(Br)c21.
What is the InChIKey of 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is URIIWMBRKQHYFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2O3/c9-6-5-4(10-11-6)2-1-3-8(5,14)7(12)13/h14H,1-3H2,(H,10,11)(H,12,13).
What are the key properties of 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 261.07 g/mol, XLogP of 0.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-hydroxy-1,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83913361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).