About 3-isocyanato-5-methyl-1,2,4-thiadiazole
3-isocyanato-5-methyl-1,2,4-thiadiazole (PubChem CID 83913977) has the molecular formula C4H3N3OS
and a molecular weight of 141.16 g/mol. Its IUPAC name is 3-isocyanato-5-methyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-isocyanato-5-methyl-1,2,4-thiadiazole |
| PubChem CID | 83913977 |
| Molecular Formula | C4H3N3OS |
| Molecular Weight | 141.16 g/mol |
| Exact Mass | 141.00 |
| IUPAC Name | 3-isocyanato-5-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nc(N=C=O)ns1 |
| InChI | InChI=1S/C4H3N3OS/c1-3-6-4(5-2-8)7-9-3/h1H3 |
| InChIKey | VZMVHOMJROSMDR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanato-5-methyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanato-5-methyl-1,2,4-thiadiazole?
The IUPAC name of 3-isocyanato-5-methyl-1,2,4-thiadiazole (CID 83913977) is 3-isocyanato-5-methyl-1,2,4-thiadiazole.
What is the SMILES notation for 3-isocyanato-5-methyl-1,2,4-thiadiazole?
The canonical SMILES for 3-isocyanato-5-methyl-1,2,4-thiadiazole is Cc1nc(N=C=O)ns1.
What is the InChIKey of 3-isocyanato-5-methyl-1,2,4-thiadiazole?
The InChIKey is VZMVHOMJROSMDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N3OS/c1-3-6-4(5-2-8)7-9-3/h1H3.
What are the key properties of 3-isocyanato-5-methyl-1,2,4-thiadiazole?
3-isocyanato-5-methyl-1,2,4-thiadiazole has a molecular weight of 141.16 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanato-5-methyl-1,2,4-thiadiazole is sourced from PubChem (CID 83913977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).