About 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one
2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one (PubChem CID 83913979) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one.
Analyze 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one?
The IUPAC name of 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one (CID 83913979) is 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one.
What is the SMILES notation for 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one?
The canonical SMILES for 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one is O=C1CCNC2COCC12.
What is the InChIKey of 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one?
The InChIKey is PYSLFAGCWGPDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c9-7-1-2-8-6-4-10-3-5(6)7/h5-6,8H,1-4H2.
What are the key properties of 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one?
2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one has a molecular weight of 141.17 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyridin-4-one is sourced from PubChem (CID 83913979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).