About (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one
(5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 839144) has the molecular formula C12H12N2OS
and a molecular weight of 232.31 g/mol. Its IUPAC name is (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 839144 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccccc2)N(C)C1=S |
| InChI | InChI=1S/C12H12N2OS/c1-13-10(11(15)14(2)12(13)16)8-9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+ |
| InChIKey | TVFNLUHIYWOUOA-CSKARUKUSA-N |
| XLogP | 1.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (CID 839144) is (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one is CN1C(=O)/C(=C\c2ccccc2)N(C)C1=S.
What is the InChIKey of (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one?
The InChIKey is TVFNLUHIYWOUOA-CSKARUKUSA-N. The full InChI is InChI=1S/C12H12N2OS/c1-13-10(11(15)14(2)12(13)16)8-9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+.
What are the key properties of (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one?
(5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one has a molecular weight of 232.31 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-benzylidene-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 839144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).