C8H13NOS — CID 83914557
1,2,3,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridin-4-one (PubChem CID 83914557) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 1,2,3,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridin-4-one.
| Compound Name | 1,2,3,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 83914557 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1,2,3,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridin-4-one |
| SMILES | O=C1CCNC2CSCCC12 |
| InChI | InChI=1S/C8H13NOS/c10-8-1-3-9-7-5-11-4-2-6(7)8/h6-7,9H,1-5H2 |
| InChIKey | AYTCLHCJTQMARJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |