About 7-isocyanato-3-methyl-1,2-benzoxazole
7-isocyanato-3-methyl-1,2-benzoxazole (PubChem CID 83914679) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 7-isocyanato-3-methyl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 7-isocyanato-3-methyl-1,2-benzoxazole |
| PubChem CID | 83914679 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 7-isocyanato-3-methyl-1,2-benzoxazole |
| SMILES | Cc1noc2c(N=C=O)cccc12 |
| InChI | InChI=1S/C9H6N2O2/c1-6-7-3-2-4-8(10-5-12)9(7)13-11-6/h2-4H,1H3 |
| InChIKey | DBCWSVUOFRUAJM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-isocyanato-3-methyl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-isocyanato-3-methyl-1,2-benzoxazole?
The IUPAC name of 7-isocyanato-3-methyl-1,2-benzoxazole (CID 83914679) is 7-isocyanato-3-methyl-1,2-benzoxazole.
What is the SMILES notation for 7-isocyanato-3-methyl-1,2-benzoxazole?
The canonical SMILES for 7-isocyanato-3-methyl-1,2-benzoxazole is Cc1noc2c(N=C=O)cccc12.
What is the InChIKey of 7-isocyanato-3-methyl-1,2-benzoxazole?
The InChIKey is DBCWSVUOFRUAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c1-6-7-3-2-4-8(10-5-12)9(7)13-11-6/h2-4H,1H3.
What are the key properties of 7-isocyanato-3-methyl-1,2-benzoxazole?
7-isocyanato-3-methyl-1,2-benzoxazole has a molecular weight of 174.16 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-isocyanato-3-methyl-1,2-benzoxazole is sourced from PubChem (CID 83914679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).