About 5-isocyanato-2-methyl-1,3-dihydroisoindole
5-isocyanato-2-methyl-1,3-dihydroisoindole (PubChem CID 83914701) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-isocyanato-2-methyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 5-isocyanato-2-methyl-1,3-dihydroisoindole |
| PubChem CID | 83914701 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5-isocyanato-2-methyl-1,3-dihydroisoindole |
| SMILES | CN1Cc2ccc(N=C=O)cc2C1 |
| InChI | InChI=1S/C10H10N2O/c1-12-5-8-2-3-10(11-7-13)4-9(8)6-12/h2-4H,5-6H2,1H3 |
| InChIKey | ANKFZVBODXSOIJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-2-methyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-2-methyl-1,3-dihydroisoindole?
The IUPAC name of 5-isocyanato-2-methyl-1,3-dihydroisoindole (CID 83914701) is 5-isocyanato-2-methyl-1,3-dihydroisoindole.
What is the SMILES notation for 5-isocyanato-2-methyl-1,3-dihydroisoindole?
The canonical SMILES for 5-isocyanato-2-methyl-1,3-dihydroisoindole is CN1Cc2ccc(N=C=O)cc2C1.
What is the InChIKey of 5-isocyanato-2-methyl-1,3-dihydroisoindole?
The InChIKey is ANKFZVBODXSOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-12-5-8-2-3-10(11-7-13)4-9(8)6-12/h2-4H,5-6H2,1H3.
What are the key properties of 5-isocyanato-2-methyl-1,3-dihydroisoindole?
5-isocyanato-2-methyl-1,3-dihydroisoindole has a molecular weight of 174.20 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-2-methyl-1,3-dihydroisoindole is sourced from PubChem (CID 83914701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).