About 5-isocyanato-1,3-benzothiazole
5-isocyanato-1,3-benzothiazole (PubChem CID 83914756) has the molecular formula C8H4N2OS
and a molecular weight of 176.20 g/mol. Its IUPAC name is 5-isocyanato-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-isocyanato-1,3-benzothiazole |
| PubChem CID | 83914756 |
| Molecular Formula | C8H4N2OS |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 5-isocyanato-1,3-benzothiazole |
| SMILES | O=C=Nc1ccc2scnc2c1 |
| InChI | InChI=1S/C8H4N2OS/c11-4-9-6-1-2-8-7(3-6)10-5-12-8/h1-3,5H |
| InChIKey | UQHFZHMZEOZMRI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-1,3-benzothiazole?
The IUPAC name of 5-isocyanato-1,3-benzothiazole (CID 83914756) is 5-isocyanato-1,3-benzothiazole.
What is the SMILES notation for 5-isocyanato-1,3-benzothiazole?
The canonical SMILES for 5-isocyanato-1,3-benzothiazole is O=C=Nc1ccc2scnc2c1.
What is the InChIKey of 5-isocyanato-1,3-benzothiazole?
The InChIKey is UQHFZHMZEOZMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2OS/c11-4-9-6-1-2-8-7(3-6)10-5-12-8/h1-3,5H.
What are the key properties of 5-isocyanato-1,3-benzothiazole?
5-isocyanato-1,3-benzothiazole has a molecular weight of 176.20 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-1,3-benzothiazole is sourced from PubChem (CID 83914756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).