5,6,7,8-tetrahydroquinazoline-2-carboxylic acid

C9H10N2O2 — CID 83914864

IUPAC5,6,7,8-tetrahydroquinazoline-2-carboxylic acid
SMILESO=C(O)c1ncc2c(n1)CCCC2
InChIInChI=1S/C9H10N2O2/c12-9(13)8-10-5-6-3-1-2-4-7(6)11-8/h5H,1-4H2,(H,12,13)
InChIKeyOSUASEYGOYAIOR-UHFFFAOYSA-N
MW178.19 g/mol
LogP1.05
Rot. Bonds1

About 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid

5,6,7,8-tetrahydroquinazoline-2-carboxylic acid (PubChem CID 83914864) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid.

Molecular Properties

Compound Name5,6,7,8-tetrahydroquinazoline-2-carboxylic acid
PubChem CID83914864
Molecular FormulaC9H10N2O2
Molecular Weight178.19 g/mol
Exact Mass178.07
IUPAC Name5,6,7,8-tetrahydroquinazoline-2-carboxylic acid
SMILESO=C(O)c1ncc2c(n1)CCCC2
InChIInChI=1S/C9H10N2O2/c12-9(13)8-10-5-6-3-1-2-4-7(6)11-8/h5H,1-4H2,(H,12,13)
InChIKeyOSUASEYGOYAIOR-UHFFFAOYSA-N
XLogP1.05
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid?
The IUPAC name of 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid (CID 83914864) is 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid.
What is the SMILES notation for 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid?
The canonical SMILES for 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid is O=C(O)c1ncc2c(n1)CCCC2.
What is the InChIKey of 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid?
The InChIKey is OSUASEYGOYAIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c12-9(13)8-10-5-6-3-1-2-4-7(6)11-8/h5H,1-4H2,(H,12,13).
What are the key properties of 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid?
5,6,7,8-tetrahydroquinazoline-2-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydroquinazoline-2-carboxylic acid is sourced from PubChem (CID 83914864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).