About 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine
2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine (PubChem CID 83914930) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine |
| PubChem CID | 83914930 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine |
| SMILES | NCCc1ncc2c(n1)CCOC2 |
| InChI | InChI=1S/C9H13N3O/c10-3-1-9-11-5-7-6-13-4-2-8(7)12-9/h5H,1-4,6,10H2 |
| InChIKey | DVTRLTDYWJGRPS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine?
The IUPAC name of 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine (CID 83914930) is 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine.
What is the SMILES notation for 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine?
The canonical SMILES for 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine is NCCc1ncc2c(n1)CCOC2.
What is the InChIKey of 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine?
The InChIKey is DVTRLTDYWJGRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c10-3-1-9-11-5-7-6-13-4-2-8(7)12-9/h5H,1-4,6,10H2.
What are the key properties of 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine?
2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine has a molecular weight of 179.22 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl)ethanamine is sourced from PubChem (CID 83914930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).