C6H6N4OS — CID 83915044
2-isocyanato-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine (PubChem CID 83915044) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 2-isocyanato-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine.
| Compound Name | 2-isocyanato-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine |
|---|---|
| PubChem CID | 83915044 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 2-isocyanato-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazine |
| SMILES | O=C=Nc1nc2n(n1)CCCS2 |
| InChI | InChI=1S/C6H6N4OS/c11-4-7-5-8-6-10(9-5)2-1-3-12-6/h1-3H2 |
| InChIKey | SFZFOODEHKLMBM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|