C11H22N2O — CID 83915974
2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-4-yl)ethanamine (PubChem CID 83915974) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-4-yl)ethanamine.
| Compound Name | 2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-4-yl)ethanamine |
|---|---|
| PubChem CID | 83915974 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-4-yl)ethanamine |
| SMILES | CN1CCC(CCN)C2COCCC21 |
| InChI | InChI=1S/C11H22N2O/c1-13-6-3-9(2-5-12)10-8-14-7-4-11(10)13/h9-11H,2-8,12H2,1H3 |
| InChIKey | HMEZMJDCOLXLOI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |