About 6-isocyanato-1,2,3-trimethylindole
6-isocyanato-1,2,3-trimethylindole (PubChem CID 83916086) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 6-isocyanato-1,2,3-trimethylindole.
Molecular Properties
| Compound Name | 6-isocyanato-1,2,3-trimethylindole |
| PubChem CID | 83916086 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 6-isocyanato-1,2,3-trimethylindole |
| SMILES | Cc1c(C)n(C)c2cc(N=C=O)ccc12 |
| InChI | InChI=1S/C12H12N2O/c1-8-9(2)14(3)12-6-10(13-7-15)4-5-11(8)12/h4-6H,1-3H3 |
| InChIKey | DIHGENBBIQBQIE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyanato-1,2,3-trimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyanato-1,2,3-trimethylindole?
The IUPAC name of 6-isocyanato-1,2,3-trimethylindole (CID 83916086) is 6-isocyanato-1,2,3-trimethylindole.
What is the SMILES notation for 6-isocyanato-1,2,3-trimethylindole?
The canonical SMILES for 6-isocyanato-1,2,3-trimethylindole is Cc1c(C)n(C)c2cc(N=C=O)ccc12.
What is the InChIKey of 6-isocyanato-1,2,3-trimethylindole?
The InChIKey is DIHGENBBIQBQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-8-9(2)14(3)12-6-10(13-7-15)4-5-11(8)12/h4-6H,1-3H3.
What are the key properties of 6-isocyanato-1,2,3-trimethylindole?
6-isocyanato-1,2,3-trimethylindole has a molecular weight of 200.24 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyanato-1,2,3-trimethylindole is sourced from PubChem (CID 83916086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).