About 5-fluoro-3-isocyanato-1,2-dimethylindole
5-fluoro-3-isocyanato-1,2-dimethylindole (PubChem CID 83916312) has the molecular formula C11H9FN2O
and a molecular weight of 204.20 g/mol. Its IUPAC name is 5-fluoro-3-isocyanato-1,2-dimethylindole.
Molecular Properties
| Compound Name | 5-fluoro-3-isocyanato-1,2-dimethylindole |
| PubChem CID | 83916312 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-fluoro-3-isocyanato-1,2-dimethylindole |
| SMILES | Cc1c(N=C=O)c2cc(F)ccc2n1C |
| InChI | InChI=1S/C11H9FN2O/c1-7-11(13-6-15)9-5-8(12)3-4-10(9)14(7)2/h3-5H,1-2H3 |
| InChIKey | HLUCGPTWKVHDCY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-isocyanato-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-isocyanato-1,2-dimethylindole?
The IUPAC name of 5-fluoro-3-isocyanato-1,2-dimethylindole (CID 83916312) is 5-fluoro-3-isocyanato-1,2-dimethylindole.
What is the SMILES notation for 5-fluoro-3-isocyanato-1,2-dimethylindole?
The canonical SMILES for 5-fluoro-3-isocyanato-1,2-dimethylindole is Cc1c(N=C=O)c2cc(F)ccc2n1C.
What is the InChIKey of 5-fluoro-3-isocyanato-1,2-dimethylindole?
The InChIKey is HLUCGPTWKVHDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O/c1-7-11(13-6-15)9-5-8(12)3-4-10(9)14(7)2/h3-5H,1-2H3.
What are the key properties of 5-fluoro-3-isocyanato-1,2-dimethylindole?
5-fluoro-3-isocyanato-1,2-dimethylindole has a molecular weight of 204.20 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-isocyanato-1,2-dimethylindole is sourced from PubChem (CID 83916312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).