About 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol
3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol (PubChem CID 83916807) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 83916807 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c10-9(11,12)8(14,6-13)7-4-2-1-3-5-7/h7,14H,1-6,13H2 |
| InChIKey | QULBKGBGXFWVET-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol (CID 83916807) is 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol is NCC(O)(C1CCCCC1)C(F)(F)F.
What is the InChIKey of 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol?
The InChIKey is QULBKGBGXFWVET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c10-9(11,12)8(14,6-13)7-4-2-1-3-5-7/h7,14H,1-6,13H2.
What are the key properties of 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol?
3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol has a molecular weight of 211.23 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-cyclohexyl-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 83916807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).