About 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol
4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol (PubChem CID 83916808) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol.
Molecular Properties
| Compound Name | 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol |
| PubChem CID | 83916808 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol |
| SMILES | NCCC(O)(C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c10-9(11,12)8(14,5-6-13)7-3-1-2-4-7/h7,14H,1-6,13H2 |
| InChIKey | VTCOKSQLMYBDMJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol?
The IUPAC name of 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol (CID 83916808) is 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol.
What is the SMILES notation for 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol?
The canonical SMILES for 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol is NCCC(O)(C1CCCC1)C(F)(F)F.
What is the InChIKey of 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol?
The InChIKey is VTCOKSQLMYBDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c10-9(11,12)8(14,5-6-13)7-3-1-2-4-7/h7,14H,1-6,13H2.
What are the key properties of 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol?
4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol has a molecular weight of 211.23 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-cyclopentyl-1,1,1-trifluorobutan-2-ol is sourced from PubChem (CID 83916808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).