About (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol
(6-bromo-2,3-dihydro-1H-indol-2-yl)methanol (PubChem CID 83918189) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol.
Molecular Properties
| Compound Name | (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol |
| PubChem CID | 83918189 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol |
| SMILES | OCC1Cc2ccc(Br)cc2N1 |
| InChI | InChI=1S/C9H10BrNO/c10-7-2-1-6-3-8(5-12)11-9(6)4-7/h1-2,4,8,11-12H,3,5H2 |
| InChIKey | NSOIFXMCSOITKA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol?
The IUPAC name of (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol (CID 83918189) is (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol.
What is the SMILES notation for (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol?
The canonical SMILES for (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol is OCC1Cc2ccc(Br)cc2N1.
What is the InChIKey of (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol?
The InChIKey is NSOIFXMCSOITKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c10-7-2-1-6-3-8(5-12)11-9(6)4-7/h1-2,4,8,11-12H,3,5H2.
What are the key properties of (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol?
(6-bromo-2,3-dihydro-1H-indol-2-yl)methanol has a molecular weight of 228.09 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dihydro-1H-indol-2-yl)methanol is sourced from PubChem (CID 83918189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).