4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid

C11H6F2N2O2 — CID 83919048

IUPAC4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid
SMILESO=C(O)c1nccc(-c2cc(F)ccc2F)n1
InChIInChI=1S/C11H6F2N2O2/c12-6-1-2-8(13)7(5-6)9-3-4-14-10(15-9)11(16)17/h1-5H,(H,16,17)
InChIKeyHABAOAPSHOEBFA-UHFFFAOYSA-N
MW236.18 g/mol
LogP2.12
Rot. Bonds2

About 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid

4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid (PubChem CID 83919048) has the molecular formula C11H6F2N2O2 and a molecular weight of 236.18 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid.

Molecular Properties

Compound Name4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid
PubChem CID83919048
Molecular FormulaC11H6F2N2O2
Molecular Weight236.18 g/mol
Exact Mass236.04
IUPAC Name4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid
SMILESO=C(O)c1nccc(-c2cc(F)ccc2F)n1
InChIInChI=1S/C11H6F2N2O2/c12-6-1-2-8(13)7(5-6)9-3-4-14-10(15-9)11(16)17/h1-5H,(H,16,17)
InChIKeyHABAOAPSHOEBFA-UHFFFAOYSA-N
XLogP2.12
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.18
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid?
The IUPAC name of 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid (CID 83919048) is 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid.
What is the SMILES notation for 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid?
The canonical SMILES for 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid is O=C(O)c1nccc(-c2cc(F)ccc2F)n1.
What is the InChIKey of 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid?
The InChIKey is HABAOAPSHOEBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N2O2/c12-6-1-2-8(13)7(5-6)9-3-4-14-10(15-9)11(16)17/h1-5H,(H,16,17).
What are the key properties of 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid?
4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid has a molecular weight of 236.18 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-difluorophenyl)pyrimidine-2-carboxylic acid is sourced from PubChem (CID 83919048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).