C10H11F4NO — CID 83919123
4-amino-1,1,1-trifluoro-2-(2-fluorophenyl)butan-2-ol (PubChem CID 83919123) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is 4-amino-1,1,1-trifluoro-2-(2-fluorophenyl)butan-2-ol.
| Compound Name | 4-amino-1,1,1-trifluoro-2-(2-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 83919123 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-amino-1,1,1-trifluoro-2-(2-fluorophenyl)butan-2-ol |
| SMILES | NCCC(O)(c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C10H11F4NO/c11-8-4-2-1-3-7(8)9(16,5-6-15)10(12,13)14/h1-4,16H,5-6,15H2 |
| InChIKey | GJSSGSBZBMDVGV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |