About 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine
2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine (PubChem CID 83919222) has the molecular formula C10H11ClF3N
and a molecular weight of 237.65 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine |
| PubChem CID | 83919222 |
| Molecular Formula | C10H11ClF3N |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine |
| SMILES | CNCC(c1ccccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3N/c1-15-6-8(10(12,13)14)7-4-2-3-5-9(7)11/h2-5,8,15H,6H2,1H3 |
| InChIKey | ADOLBXFHJSFKDI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine?
The IUPAC name of 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine (CID 83919222) is 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine.
What is the SMILES notation for 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine?
The canonical SMILES for 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine is CNCC(c1ccccc1Cl)C(F)(F)F.
What is the InChIKey of 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine?
The InChIKey is ADOLBXFHJSFKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF3N/c1-15-6-8(10(12,13)14)7-4-2-3-5-9(7)11/h2-5,8,15H,6H2,1H3.
What are the key properties of 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine?
2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine has a molecular weight of 237.65 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-3,3,3-trifluoro-N-methylpropan-1-amine is sourced from PubChem (CID 83919222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).