C12H19NO6 — CID 83920487
cis-dimethyl (1R,2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1,2-dicarboxylate (PubChem CID 83920487) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is cis-dimethyl (1R,2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1,2-dicarboxylate.
| Compound Name | cis-dimethyl (1R,2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 83920487 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | cis-dimethyl (1R,2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(NC(=O)OC(C)(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H19NO6/c1-12(2,3)19-11(16)13-8-6(9(14)17-4)7(8)10(15)18-5/h6-8H,1-5H3,(H,13,16)/t6-,7+,8? |
| InChIKey | UVEQGRCQHRVRSP-DHBOJHSNSA-N |
| XLogP | 0.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|