C13H22N2O — CID 83922952
4-[4-amino-3-(aminomethyl)-2-methylbutyl]-2-methylphenol (PubChem CID 83922952) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-[4-amino-3-(aminomethyl)-2-methylbutyl]-2-methylphenol.
| Compound Name | 4-[4-amino-3-(aminomethyl)-2-methylbutyl]-2-methylphenol |
|---|---|
| PubChem CID | 83922952 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-[4-amino-3-(aminomethyl)-2-methylbutyl]-2-methylphenol |
| SMILES | Cc1cc(CC(C)C(CN)CN)ccc1O |
| InChI | InChI=1S/C13H22N2O/c1-9(12(7-14)8-15)5-11-3-4-13(16)10(2)6-11/h3-4,6,9,12,16H,5,7-8,14-15H2,1-2H3 |
| InChIKey | BQWYNIJDXNCMPN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |