About 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one
5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one (PubChem CID 83930172) has the molecular formula C11H12F6N2O
and a molecular weight of 302.22 g/mol. Its IUPAC name is 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one.
Molecular Properties
| Compound Name | 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one |
| PubChem CID | 83930172 |
| Molecular Formula | C11H12F6N2O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one |
| SMILES | CC(=O)CCCc1c(C(F)(F)F)nn(C)c1C(F)(F)F |
| InChI | InChI=1S/C11H12F6N2O/c1-6(20)4-3-5-7-8(10(12,13)14)18-19(2)9(7)11(15,16)17/h3-5H2,1-2H3 |
| InChIKey | SUXADFMYUGACGM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one?
The IUPAC name of 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one (CID 83930172) is 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one.
What is the SMILES notation for 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one?
The canonical SMILES for 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one is CC(=O)CCCc1c(C(F)(F)F)nn(C)c1C(F)(F)F.
What is the InChIKey of 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one?
The InChIKey is SUXADFMYUGACGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F6N2O/c1-6(20)4-3-5-7-8(10(12,13)14)18-19(2)9(7)11(15,16)17/h3-5H2,1-2H3.
What are the key properties of 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one?
5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one has a molecular weight of 302.22 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentan-2-one is sourced from PubChem (CID 83930172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).