About 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane
2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane (PubChem CID 83931662) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane.
Molecular Properties
| Compound Name | 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane |
| PubChem CID | 83931662 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane |
| SMILES | Cc1cc(F)c(CCC2CO2)cc1C |
| InChI | InChI=1S/C12H15FO/c1-8-5-10(3-4-11-7-14-11)12(13)6-9(8)2/h5-6,11H,3-4,7H2,1-2H3 |
| InChIKey | BRYUNBVPVJOJTF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane?
The IUPAC name of 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane (CID 83931662) is 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane.
What is the SMILES notation for 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane?
The canonical SMILES for 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane is Cc1cc(F)c(CCC2CO2)cc1C.
What is the InChIKey of 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane?
The InChIKey is BRYUNBVPVJOJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO/c1-8-5-10(3-4-11-7-14-11)12(13)6-9(8)2/h5-6,11H,3-4,7H2,1-2H3.
What are the key properties of 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane?
2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane has a molecular weight of 194.25 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluoro-4,5-dimethylphenyl)ethyl]oxirane is sourced from PubChem (CID 83931662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).