C17H21Cl — CID 83931906
6-chloro-7-hept-1-yn-4-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 83931906) has the molecular formula C17H21Cl and a molecular weight of 260.81 g/mol. Its IUPAC name is 6-chloro-7-hept-1-yn-4-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-chloro-7-hept-1-yn-4-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 83931906 |
| Molecular Formula | C17H21Cl |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-chloro-7-hept-1-yn-4-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C#CCC(CCC)c1cc2c(cc1Cl)CCCC2 |
| InChI | InChI=1S/C17H21Cl/c1-3-7-13(8-4-2)16-11-14-9-5-6-10-15(14)12-17(16)18/h1,11-13H,4-10H2,2H3 |
| InChIKey | PPAPRBGJTSNMAJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|