C19H28O3 — CID 83932519
methyl 2-[2-[2-(2-methylpropoxy)phenyl]butyl]cyclopropane-1-carboxylate (PubChem CID 83932519) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is methyl 2-[2-[2-(2-methylpropoxy)phenyl]butyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-[2-[2-(2-methylpropoxy)phenyl]butyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 83932519 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | methyl 2-[2-[2-(2-methylpropoxy)phenyl]butyl]cyclopropane-1-carboxylate |
| SMILES | CCC(CC1CC1C(=O)OC)c1ccccc1OCC(C)C |
| InChI | InChI=1S/C19H28O3/c1-5-14(10-15-11-17(15)19(20)21-4)16-8-6-7-9-18(16)22-12-13(2)3/h6-9,13-15,17H,5,10-12H2,1-4H3 |
| InChIKey | KGCXBQOEYXXBFK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |