C11H14BrFO2 — CID 83933937
5-(5-bromo-2-fluorophenyl)pentane-2,3-diol (PubChem CID 83933937) has the molecular formula C11H14BrFO2 and a molecular weight of 277.13 g/mol. Its IUPAC name is 5-(5-bromo-2-fluorophenyl)pentane-2,3-diol.
| Compound Name | 5-(5-bromo-2-fluorophenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83933937 |
| Molecular Formula | C11H14BrFO2 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 5-(5-bromo-2-fluorophenyl)pentane-2,3-diol |
| SMILES | CC(O)C(O)CCc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H14BrFO2/c1-7(14)11(15)5-2-8-6-9(12)3-4-10(8)13/h3-4,6-7,11,14-15H,2,5H2,1H3 |
| InChIKey | CVRIRSMUNMUVOU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |