C8H11ClO2S — CID 83934930
4-(5-chlorothiophen-2-yl)butane-1,2-diol (PubChem CID 83934930) has the molecular formula C8H11ClO2S and a molecular weight of 206.69 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)butane-1,2-diol.
| Compound Name | 4-(5-chlorothiophen-2-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 83934930 |
| Molecular Formula | C8H11ClO2S |
| Molecular Weight | 206.69 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)butane-1,2-diol |
| SMILES | OCC(O)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H11ClO2S/c9-8-4-3-7(12-8)2-1-6(11)5-10/h3-4,6,10-11H,1-2,5H2 |
| InChIKey | CJYGCWWRQBNXJQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.69 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |