C9H13BrO2S — CID 83935049
5-(5-bromothiophen-2-yl)pentane-2,3-diol (PubChem CID 83935049) has the molecular formula C9H13BrO2S and a molecular weight of 265.17 g/mol. Its IUPAC name is 5-(5-bromothiophen-2-yl)pentane-2,3-diol.
| Compound Name | 5-(5-bromothiophen-2-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83935049 |
| Molecular Formula | C9H13BrO2S |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 5-(5-bromothiophen-2-yl)pentane-2,3-diol |
| SMILES | CC(O)C(O)CCc1ccc(Br)s1 |
| InChI | InChI=1S/C9H13BrO2S/c1-6(11)8(12)4-2-7-3-5-9(10)13-7/h3,5-6,8,11-12H,2,4H2,1H3 |
| InChIKey | JYIBIGIBVGCVKB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |