C16H27NO — CID 83935409
4-amino-1-(5-tert-butyl-2-methylphenyl)pentan-3-ol (PubChem CID 83935409) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-amino-1-(5-tert-butyl-2-methylphenyl)pentan-3-ol.
| Compound Name | 4-amino-1-(5-tert-butyl-2-methylphenyl)pentan-3-ol |
|---|---|
| PubChem CID | 83935409 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-amino-1-(5-tert-butyl-2-methylphenyl)pentan-3-ol |
| SMILES | Cc1ccc(C(C)(C)C)cc1CCC(O)C(C)N |
| InChI | InChI=1S/C16H27NO/c1-11-6-8-14(16(3,4)5)10-13(11)7-9-15(18)12(2)17/h6,8,10,12,15,18H,7,9,17H2,1-5H3 |
| InChIKey | UEYOVALLDFEXHH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |