C14H20O — CID 83939746
1-methoxy-2,3-dimethyl-4-[(Z)-pent-3-enyl]benzene (PubChem CID 83939746) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-methoxy-2,3-dimethyl-4-[(Z)-pent-3-enyl]benzene.
| Compound Name | 1-methoxy-2,3-dimethyl-4-[(Z)-pent-3-enyl]benzene |
|---|---|
| PubChem CID | 83939746 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-methoxy-2,3-dimethyl-4-[(Z)-pent-3-enyl]benzene |
| SMILES | C/C=C\CCc1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C14H20O/c1-5-6-7-8-13-9-10-14(15-4)12(3)11(13)2/h5-6,9-10H,7-8H2,1-4H3/b6-5- |
| InChIKey | WBMXTLPYDKGAFM-WAYWQWQTSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|