C19H30N2O2 — CID 83940218
4-(4-ethoxy-2,6-dimethylphenyl)-1-piperazin-1-ylpentan-1-one (PubChem CID 83940218) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-(4-ethoxy-2,6-dimethylphenyl)-1-piperazin-1-ylpentan-1-one.
| Compound Name | 4-(4-ethoxy-2,6-dimethylphenyl)-1-piperazin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 83940218 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 4-(4-ethoxy-2,6-dimethylphenyl)-1-piperazin-1-ylpentan-1-one |
| SMILES | CCOc1cc(C)c(C(C)CCC(=O)N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C19H30N2O2/c1-5-23-17-12-15(3)19(16(4)13-17)14(2)6-7-18(22)21-10-8-20-9-11-21/h12-14,20H,5-11H2,1-4H3 |
| InChIKey | LNGNQEYMZKGIBR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |