C14H20O — CID 83941974
2-methoxy-1,5-dimethyl-3-pent-4-en-2-ylbenzene (PubChem CID 83941974) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-methoxy-1,5-dimethyl-3-pent-4-en-2-ylbenzene.
| Compound Name | 2-methoxy-1,5-dimethyl-3-pent-4-en-2-ylbenzene |
|---|---|
| PubChem CID | 83941974 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-methoxy-1,5-dimethyl-3-pent-4-en-2-ylbenzene |
| SMILES | C=CCC(C)c1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C14H20O/c1-6-7-11(3)13-9-10(2)8-12(4)14(13)15-5/h6,8-9,11H,1,7H2,2-5H3 |
| InChIKey | RUNHQMFFJWCPAM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|