C12H15NO — CID 83945019
1-(5,6-dimethyl-1H-indol-3-yl)ethanol (PubChem CID 83945019) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1H-indol-3-yl)ethanol.
| Compound Name | 1-(5,6-dimethyl-1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 83945019 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(5,6-dimethyl-1H-indol-3-yl)ethanol |
| SMILES | Cc1cc2[nH]cc(C(C)O)c2cc1C |
| InChI | InChI=1S/C12H15NO/c1-7-4-10-11(9(3)14)6-13-12(10)5-8(7)2/h4-6,9,13-14H,1-3H3 |
| InChIKey | FNIOSUYRJTURFA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |