About methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate
methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate (PubChem CID 83946522) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate |
| PubChem CID | 83946522 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate |
| SMILES | CCN1CCc2c(c3cc(C)cc(C(=O)OC)c3n2CCCO)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-4-20-8-6-17-16(12-20)14-10-13(2)11-15(19(23)24-3)18(14)21(17)7-5-9-22/h10-11,22H,4-9,12H2,1-3H3 |
| InChIKey | KKRHUDWJSPOEFS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate?
The IUPAC name of methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate (CID 83946522) is methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate.
What is the SMILES notation for methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate?
The canonical SMILES for methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate is CCN1CCc2c(c3cc(C)cc(C(=O)OC)c3n2CCCO)C1.
What is the InChIKey of methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate?
The InChIKey is KKRHUDWJSPOEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-4-20-8-6-17-16(12-20)14-10-13(2)11-15(19(23)24-3)18(14)21(17)7-5-9-22/h10-11,22H,4-9,12H2,1-3H3.
What are the key properties of methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate?
methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate has a molecular weight of 330.43 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-5-(3-hydroxypropyl)-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate is sourced from PubChem (CID 83946522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).