3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid

C13H13NO3 — CID 83947065

IUPAC3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid
SMILESCC(=O)c1c[nH]c2c(C)cc(C(=O)O)c(C)c12
InChIInChI=1S/C13H13NO3/c1-6-4-9(13(16)17)7(2)11-10(8(3)15)5-14-12(6)11/h4-5,14H,1-3H3,(H,16,17)
InChIKeyYMUQZUBPEHYYNC-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.69
Rot. Bonds2

About 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid

3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid (PubChem CID 83947065) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid.

Molecular Properties

Compound Name3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid
PubChem CID83947065
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid
SMILESCC(=O)c1c[nH]c2c(C)cc(C(=O)O)c(C)c12
InChIInChI=1S/C13H13NO3/c1-6-4-9(13(16)17)7(2)11-10(8(3)15)5-14-12(6)11/h4-5,14H,1-3H3,(H,16,17)
InChIKeyYMUQZUBPEHYYNC-UHFFFAOYSA-N
XLogP2.69
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid?
The IUPAC name of 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid (CID 83947065) is 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid.
What is the SMILES notation for 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid?
The canonical SMILES for 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid is CC(=O)c1c[nH]c2c(C)cc(C(=O)O)c(C)c12.
What is the InChIKey of 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid?
The InChIKey is YMUQZUBPEHYYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-6-4-9(13(16)17)7(2)11-10(8(3)15)5-14-12(6)11/h4-5,14H,1-3H3,(H,16,17).
What are the key properties of 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid?
3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid has a molecular weight of 231.25 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4,7-dimethyl-1H-indole-5-carboxylic acid is sourced from PubChem (CID 83947065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).