C15H19NO2 — CID 83947605
1-[1-(3-hydroxypropyl)-5,7-dimethylindol-3-yl]ethanone (PubChem CID 83947605) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 1-[1-(3-hydroxypropyl)-5,7-dimethylindol-3-yl]ethanone.
| Compound Name | 1-[1-(3-hydroxypropyl)-5,7-dimethylindol-3-yl]ethanone |
|---|---|
| PubChem CID | 83947605 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-[1-(3-hydroxypropyl)-5,7-dimethylindol-3-yl]ethanone |
| SMILES | CC(=O)c1cn(CCCO)c2c(C)cc(C)cc12 |
| InChI | InChI=1S/C15H19NO2/c1-10-7-11(2)15-13(8-10)14(12(3)18)9-16(15)5-4-6-17/h7-9,17H,4-6H2,1-3H3 |
| InChIKey | JRFSOUKKAFBKMA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |