C17H24N4O2 — CID 83947850
1-(2-aminoethyl)-3-(2-piperazin-1-ylethyl)indole-4-carboxylic acid (PubChem CID 83947850) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(2-piperazin-1-ylethyl)indole-4-carboxylic acid.
| Compound Name | 1-(2-aminoethyl)-3-(2-piperazin-1-ylethyl)indole-4-carboxylic acid |
|---|---|
| PubChem CID | 83947850 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-(2-aminoethyl)-3-(2-piperazin-1-ylethyl)indole-4-carboxylic acid |
| SMILES | NCCn1cc(CCN2CCNCC2)c2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C17H24N4O2/c18-5-9-21-12-13(4-8-20-10-6-19-7-11-20)16-14(17(22)23)2-1-3-15(16)21/h1-3,12,19H,4-11,18H2,(H,22,23) |
| InChIKey | HUTAFNQAGMNPME-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |