C16H17NO4 — CID 83948261
9-(carboxymethyl)-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 83948261) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 9-(carboxymethyl)-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-(carboxymethyl)-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 83948261 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 9-(carboxymethyl)-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CC1CCc2c(c3cc(C(=O)O)ccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C16H17NO4/c1-9-2-4-13-11(6-9)12-7-10(16(20)21)3-5-14(12)17(13)8-15(18)19/h3,5,7,9H,2,4,6,8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | YLUDOPGSELDSRQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|