C6H8ClN3 — CID 83949413
2-(chloromethyl)-1,4,5,6-tetrahydropyrrolo[3,4-d]imidazole (PubChem CID 83949413) has the molecular formula C6H8ClN3 and a molecular weight of 157.60 g/mol. Its IUPAC name is 2-(chloromethyl)-1,4,5,6-tetrahydropyrrolo[3,4-d]imidazole.
| Compound Name | 2-(chloromethyl)-1,4,5,6-tetrahydropyrrolo[3,4-d]imidazole |
|---|---|
| PubChem CID | 83949413 |
| Molecular Formula | C6H8ClN3 |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2-(chloromethyl)-1,4,5,6-tetrahydropyrrolo[3,4-d]imidazole |
| SMILES | ClCc1nc2c([nH]1)CNC2 |
| InChI | InChI=1S/C6H8ClN3/c7-1-6-9-4-2-8-3-5(4)10-6/h8H,1-3H2,(H,9,10) |
| InChIKey | QIUYABJHCSFQSY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|