About 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane
2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane (PubChem CID 83949783) has the molecular formula C13H15F3O3
and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane |
| PubChem CID | 83949783 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane |
| SMILES | CCC1(c2ccc(C(F)(F)F)cc2OC)OCCO1 |
| InChI | InChI=1S/C13H15F3O3/c1-3-12(18-6-7-19-12)10-5-4-9(13(14,15)16)8-11(10)17-2/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | ZEBVYJMKSZJAKO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane?
The IUPAC name of 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane (CID 83949783) is 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane.
What is the SMILES notation for 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane?
The canonical SMILES for 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane is CCC1(c2ccc(C(F)(F)F)cc2OC)OCCO1.
What is the InChIKey of 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane?
The InChIKey is ZEBVYJMKSZJAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O3/c1-3-12(18-6-7-19-12)10-5-4-9(13(14,15)16)8-11(10)17-2/h4-5,8H,3,6-7H2,1-2H3.
What are the key properties of 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane?
2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane has a molecular weight of 276.25 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[2-methoxy-4-(trifluoromethyl)phenyl]-1,3-dioxolane is sourced from PubChem (CID 83949783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).