C17H17ClO3 — CID 83952274
3-(3-chloro-4-hydroxyphenyl)-2-(4-ethylphenyl)propanoic acid (PubChem CID 83952274) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is 3-(3-chloro-4-hydroxyphenyl)-2-(4-ethylphenyl)propanoic acid.
| Compound Name | 3-(3-chloro-4-hydroxyphenyl)-2-(4-ethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83952274 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-(3-chloro-4-hydroxyphenyl)-2-(4-ethylphenyl)propanoic acid |
| SMILES | CCc1ccc(C(Cc2ccc(O)c(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17ClO3/c1-2-11-3-6-13(7-4-11)14(17(20)21)9-12-5-8-16(19)15(18)10-12/h3-8,10,14,19H,2,9H2,1H3,(H,20,21) |
| InChIKey | VUAUWTZZLAITHR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |