C21H26O4 — CID 83952981
3-(2,4-diethoxyphenyl)-2-(4-ethylphenyl)propanoic acid (PubChem CID 83952981) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-(2,4-diethoxyphenyl)-2-(4-ethylphenyl)propanoic acid.
| Compound Name | 3-(2,4-diethoxyphenyl)-2-(4-ethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83952981 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-(2,4-diethoxyphenyl)-2-(4-ethylphenyl)propanoic acid |
| SMILES | CCOc1ccc(CC(C(=O)O)c2ccc(CC)cc2)c(OCC)c1 |
| InChI | InChI=1S/C21H26O4/c1-4-15-7-9-16(10-8-15)19(21(22)23)13-17-11-12-18(24-5-2)14-20(17)25-6-3/h7-12,14,19H,4-6,13H2,1-3H3,(H,22,23) |
| InChIKey | GYGCPGNHGJPNRG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |